Systematic / IUPAC Name: 4-Nitrobenzoic acid
ID: Reference2984
            Other Names: 
                    PNBA; 
                    p-Nitrobenzenecarboxylic acid; 
                    p-Nitrobenzoic acid; 
                    p-Nitrodracylic acid; 
                    1-Carboxy-4-nitrobenzene
; more
        
Formula: C7H5NO4
Class: Industrial Chemicals
4-Nitrobenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap | 
| No. of Spectral Trees | 1 | 
| No. of Spectra | 74 | 
| Tandem Spectra | MS1, MS2 | 
| Ionization Methods | APCI | 
| Analyzers | FT | 
| Last Modification | 8/26/2015 7:05:56 AM | 
| InChI | InChI=1S/C7H5NO4/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4H,(H,9,10) | 
| InChI Key | OTLNPYWUJOZPPA-UHFFFAOYSA-N | 
| Canonical SMILES | C1=CC(=CC=C1C(=O)O)[N+](=O)[O-] | 
| CAS | 62237 | 
| Splash | |
| Other Names | PNBA; p-Nitrobenzenecarboxylic acid; p-Nitrobenzoic acid; p-Nitrodracylic acid; 1-Carboxy-4-nitrobenzene; 4-Nitrobenzenecarboxylic acid; 4-Nitro-benzoic acid; 4-Nitrodracylic acid; Benzoic acid, p-nitro-; Benzoic acid, 4-nitro-; Nitrodracylic acid | 
| Wikipedia | 4-Nitrobenzoic_acid | 
| KEGG | C18625 | 
| ChEBI | CHEBI:262350 | 
| ChemIDPlus | 000062237; 034067500; 073680907; 003847572; 035363496 | 
| PubChem | 6108 | 
| ChemSpider | 5882 |