Ethylene glycol tetraacetic acid (EGTA)
Ethylene glycol tetraacetic acid (EGTA) Structure
Systematic / IUPAC Name: 3,12-Bis(carboxymethyl)-6,9-dioxa-3,12-diazatetradecane-1,14-dioic acid
ID: Reference718
Other Names:
Ethylenebis(oxyethylenenitrilo)tetraacetic acid;
Ethylene glycol bis(2-aminoethyl ether)tetraacetic acid;
1,2-Bis[2-[bis(carboxymethyl)amino]ethoxy]ethane;
Ethylenedioxybis(ethyleneamino)tetraacetic acid;
Acetic acid, (ethylenebis(oxyethylenenitrilo))tetra-
; more
Formula: C14H24N2O10
Spectral Data
Ethylene glycol tetraacetic acid (EGTA) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
Available MS Data
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2015 10:18:52 AM |
Identificators
| InChI | InChI=1S/C14H24N2O10/c17-11(18)7-15(8-12(19)20)1-3-25-5-6-26-4-2-16(9-13(21)22)10-14(23)24/h1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Canonical SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| CAS | 67425 |
| Splash | |
| Other Names |
Ethylenebis(oxyethylenenitrilo)tetraacetic acid; Ethylene glycol bis(2-aminoethyl ether)tetraacetic acid; 1,2-Bis[2-[bis(carboxymethyl)amino]ethoxy]ethane; Ethylenedioxybis(ethyleneamino)tetraacetic acid; Acetic acid, (ethylenebis(oxyethylenenitrilo))tetra-; 2-[2-[2-[2-(Bis(carboxymethyl)amino)ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid; Glycoletherdiamine-tetraacetic acid; GEDTA; Egtazic acid |
In Other Databases
| ChemIDPlus | 000067425; 031571718; 026082780; 021308043 |
| ChEBI | CHEBI:30740 |
| ChEMBL | CHEMBL240390 |
| KEGG | D03967 |
| ChemSpider | 5972 |
| PubChem | 6207 |
| Wikipedia | EGTA (chemical) |