Systematic / IUPAC Name: (2E)-4-(4-Ethoxyphenyl)-4-oxo-2-butenoic acid
ID: Reference7079
Other Names:
(E)-4-(4-Ethoxyphenyl)-4-oxobut-2-enoic acid;
(2E)-4-(4-Ethoxyphenyl)-4-oxobut-2-enoic acid;
(4-Ethoxybenzoyl)-3-acrylic acid;
2-Butenoic acid,4-(4-ethoxyphenyl)-4-oxo-,(2E)-;
3-(4-Ethoxybenzoyl)acrylic acid
Formula: C12H12O4
4-(4-Ethoxyphenyl)-4-oxobut-2-enoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/24/2017 10:53:52 AM |
| InChI | InChI=1S/C12H12O4/c1-2-16-10-5-3-9(4-6-10)11(13)7-8-12(14)15/h3-8H,2H2,1H3,(H,14,15)/b8-7+ |
| InChI Key | WKIKNOMECIZQHQ-BQYQJAHWSA-N |
| Canonical SMILES | CCOC1=CC=C(C=C1)C(=O)C=CC(=O)O |
| CAS | 29582318 |
| Splash | |
| Other Names |
(E)-4-(4-Ethoxyphenyl)-4-oxobut-2-enoic acid; (2E)-4-(4-Ethoxyphenyl)-4-oxobut-2-enoic acid; (4-Ethoxybenzoyl)-3-acrylic acid; 2-Butenoic acid,4-(4-ethoxyphenyl)-4-oxo-,(2E)-; 3-(4-Ethoxybenzoyl)acrylic acid |