Oxymatrine
Oxymatrine Structure
Systematic / IUPAC Name: (7aS,13aR,13bR,13cS)Dodecahydro-1H,5H,10H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one 4-oxide
ID: Reference6130
Other Names:
(4S,41S,7aS,13aR,13bR)-10-Oxododecahydro-1H,5H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridine 4(41H)-oxide;
(41S,7aS,13aR,13bR)-10-Oxohexadecahydrodipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridine 4-oxide;
1H,5H,10H-Dipyrido(2,1-f:3',2',1'-ij)(1,6)naphthyridin-10-one, dodecahydro, 4-oxide, (4R,7aS,13aR,13bR,13cS)-;
Ammothamnine;
Matridin-15-one, 1-oxide, (1-β)-
; more
Formula: C15H24N2O2
Class: Endogenous Metabolites Natural Products/Medicines
Spectral Data
Oxymatrine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
Available MS Data
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2322 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 12/12/2016 10:09:16 AM |
Identificators
| InChI | InChI=1S/C15H24N2O2/c18-14-7-1-6-13-12-5-3-9-17(19)8-2-4-11(15(12)17)10-16(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-,17?/m0/s1 |
| InChI Key | XVPBINOPNYFXID-LHDUFFHYSA-N |
| Canonical SMILES | |
| CAS | 16837528 |
| Splash | |
| Other Names |
(4S,41S,7aS,13aR,13bR)-10-Oxododecahydro-1H,5H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridine 4(41H)-oxide; (41S,7aS,13aR,13bR)-10-Oxohexadecahydrodipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridine 4-oxide; 1H,5H,10H-Dipyrido(2,1-f:3',2',1'-ij)(1,6)naphthyridin-10-one, dodecahydro, 4-oxide, (4R,7aS,13aR,13bR,13cS)-; Ammothamnine; Matridin-15-one, 1-oxide, (1-β)-; Matrine N-oxide; Matrine 1β-oxide; Matrine oxide; Matrine, 1-oxide; Oxysophoridine |
In Other Databases
| ChemIDPlus | 016837528 |
| PubChem | 114850 |
| KEGG | C10749 |
| ChEBI | CHEBI:2672 |
| ChEMBL | CHEMBL458337 |
| ChemSpider | 102808 |
| Wikipedia | Oxymatrine |