L-Kynurenine
L-Kynurenine Structure
Systematic / IUPAC Name: (2S)-2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid
ID: Reference478
Other Names:
(S)-2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid;
L-2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid;
3-(2-Aminobenzoyl)-L-alanine;
α,2-Diamino-Υ-oxo-benzenebutanoic acid;
(S)-α,2-Diamino-3-hydroxy-Υ-oxo-benzenebutanoic acid
; more
Formula: C10H12N2O3
Class: Endogenous Metabolites
Spectral Data
L-Kynurenine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
Available MS Data
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 226 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/27/2015 9:09:32 AM |
Identificators
| InChI | InChI=1S/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15)/t8-/m0/s1 |
| InChI Key | YGPSJZOEDVAXAB-QMMMGPOBSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)CC(C(=O)O)N)N |
| CAS | 2922830 |
| Splash | |
| Other Names |
(S)-2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid; L-2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid; 3-(2-Aminobenzoyl)-L-alanine; α,2-Diamino-Υ-oxo-benzenebutanoic acid; (S)-α,2-Diamino-3-hydroxy-Υ-oxo-benzenebutanoic acid; Kynurenine, L-; Kynurenin; Quinurenine; β-Anthraniloyl-L-alanine |
In Other Databases
| Wikipedia | Kynurenine |
| PubChem | 161166 |
| ChemIDPlus | 002922830 |
| ChEBI | CHEBI:16946; CHEBI:57959 |
| ChemSpider | 141580 |
| ChEMBL | CHEMBL498416 |
| HMDb | HMDB00183; HMDB00684 |
| KEGG | C00328 |