Systematic / IUPAC Name: Methyl 2-acetamido-5-nitrobenzoate
ID: Reference3642
Other Names: Benzoic acid,2-(acetylamino)-5-nitro-, methyl ester
Formula: C10H10N2O5
Methyl 2-(acetylamino)-5-nitrobenzoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/26/2016 1:17:25 PM |
| InChI | InChI=1S/C10H10N2O5/c1-6(13)11-9-4-3-7(12(15)16)5-8(9)10(14)17-2/h3-5H,1-2H3,(H,11,13) |
| InChI Key | HAKPLTBAUCAFMV-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | 5409450 |
| Splash | |
| Other Names | Benzoic acid,2-(acetylamino)-5-nitro-, methyl ester |