Systematic / IUPAC Name: Ethyl 3,4-dihydroxybenzoate
ID: Reference3463
Other Names:
3,4-Dihydroxybenzoic acid ethyl ester;
3,4-Dihydroxyethyl benzoate;
Benzoic acid, 3,4-dihydroxy-, ethyl ester;
Ethyl3,4-dihydroxybenzoate;
Protocatechuic acid ethyl ester
Formula: C9H10O4
Class: Endogenous Metabolites Excipients/Additives/Colorants Natural Products/Medicines
Ethyl protocatechuate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1259 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 12/3/2015 11:29:58 AM |
| InChI | InChI=1S/C9H10O4/c1-2-13-9(12)6-3-4-7(10)8(11)5-6/h3-5,10-11H,2H2,1H3 |
| InChI Key | KBPUBCVJHFXPOC-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=CC(=C(C=C1)O)O |
| CAS | 3943893 |
| Splash | |
| Other Names |
3,4-Dihydroxybenzoic acid ethyl ester; 3,4-Dihydroxyethyl benzoate; Benzoic acid, 3,4-dihydroxy-, ethyl ester; Ethyl3,4-dihydroxybenzoate; Protocatechuic acid ethyl ester |
| ChemIDPlus | 003943893 |
| Wikipedia | Ethyl protocatechuate |
| ChemSpider | 69954 |
| PubChem | 77547 |