Systematic / IUPAC Name: Ethyl 4-acetyl-5-oxohexanoate
ID: Reference2602
            Other Names: 
                    4-Acetyl-5-oxohexanoic acid ethyl ester; 
                    Ethyl 4,4-diacetylbutyrate; 
                    Hexanoic acid, 4-acetyl-5-oxo-, ethyl ester
        
Formula: C10H16O4
Ethyl 4-acetyl-5-oxohexanoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap | 
| No. of Spectral Trees | 2 | 
| No. of Spectra | 169 | 
| Tandem Spectra | MS1, MS2 | 
| Ionization Methods | ESI | 
| Analyzers | FT | 
| Last Modification | 4/20/2015 7:20:52 AM | 
| InChI | InChI=1S/C10H16O4/c1-4-14-10(13)6-5-9(7(2)11)8(3)12/h9H,4-6H2,1-3H3 | 
| InChI Key | YRSGDLIATOURQO-UHFFFAOYSA-N | 
| Canonical SMILES | CCOC(=O)CCC(C(=O)C)C(=O)C | 
| CAS | 2832102 | 
| Splash | |
| Other Names | 
                        4-Acetyl-5-oxohexanoic acid ethyl ester;  Ethyl 4,4-diacetylbutyrate; Hexanoic acid, 4-acetyl-5-oxo-, ethyl ester  |