L-Methionine sulfoxide
2246
Reference
L-Methionine sulfoxide Structure
Systematic / IUPAC Name: (2S)-2-Amino-4-methylsulfinylbutanoic acid
ID: Reference2246
Other Names:
Methionine sulfoxide;
L-Methionine S-oxide;
Methionine S-oxide;
L-2-Amino-4-(methylsulfinyl)butanoic acid
Formula: C5H11NO3S
Class: Endogenous Metabolites
Spectral Data
L-Methionine sulfoxide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
Available MS Data
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/12/2015 9:05:35 AM |
Identificators
| InChI | InChI=1S/C5H11NO3S/c1-10(9)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-,10?/m0/s1 |
| InChI Key | QEFRNWWLZKMPFJ-YGVKFDHGSA-N |
| Canonical SMILES | CS(=O)CCC(C(=O)O)N |
| CAS | 3226651 |
| Splash | |
| Other Names |
Methionine sulfoxide; L-Methionine S-oxide; Methionine S-oxide; L-2-Amino-4-(methylsulfinyl)butanoic acid |
In Other Databases
| KEGG | C02989 |
| ChemSpider | 139840 |
| ChEBI | CHEBI:17016 |
| PubChem | 158980 |
| Wikipedia | Methionine sulfoxide |
| ChEMBL | CHEMBL445753 |
| ChemIDPlus | 086631494 |