L-5-Hydroxytryptophan
L-5-Hydroxytryptophan Structure
Systematic / IUPAC Name: (2S)-2-Amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid
ID: Reference1540
Other Names:
5-Hydroxy-L-tryptophan;
L-Tryptophan, 5-hydroxy-;
L-2-Amino-3-(5-hydroxyindolyl)propionic acid;
(2S)-2-Amino-3-(5-hydroxyindol-3-yl)propanoic acid;
S(+)-1-α-Amino-5-hydroxyindole-3-propionic acid
; more
Formula: C11H12N2O3
Class: Endogenous Metabolites Therapeutics/Prescription Drugs
Spectral Data
L-5-Hydroxytryptophan mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
Available MS Data
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/2/2014 2:00:39 PM |
Identificators
| InChI | InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16)/t9-/m0/s1 |
| InChI Key | LDCYZAJDBXYCGN-VIFPVBQESA-N |
| Canonical SMILES | C1=CC2=C(C=C1O)C(=CN2)CC(C(=O)O)N |
| CAS | 4350098 |
| Splash | |
| Other Names |
5-Hydroxy-L-tryptophan; L-Tryptophan, 5-hydroxy-; L-2-Amino-3-(5-hydroxyindolyl)propionic acid; (2S)-2-Amino-3-(5-hydroxyindol-3-yl)propanoic acid; S(+)-1-α-Amino-5-hydroxyindole-3-propionic acid; Oxitriptan; Levothym; Cincofarm |
In Other Databases
| ChemIDPlus | 000056699; 004350098; 000114034 |
| ChEBI | CHEBI:28171 |
| HMDb | HMDB00472 |
| ChemSpider | 388413 |
| PubChem | 439280 |
| KEGG | C01017 |
| ChEMBL | CHEMBL162789 |
| Wikipedia | 5-Hydroxytryptophan |