Pyruvic acid
1264
Reference
Pyruvic acid Structure
Systematic / IUPAC Name: 2-Oxopropanoic acid
ID: Reference1264
Other Names:
Acetylformic acid;
2-Oxopropionic acid;
α-Ketopropionic acid;
2-Ketopropionic acid;
Pyroracemic acid
; more
Formula: C3H4O3
Class: Endogenous Metabolites
Spectral Data
Pyruvic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
Available MS Data
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 128 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/17/2016 1:58:41 PM |
Identificators
| InChI | InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6) |
| InChI Key | LCTONWCANYUPML-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)C(=O)O |
| CAS | 127173 |
| Splash | |
| Other Names |
Acetylformic acid; 2-Oxopropionic acid; α-Ketopropionic acid; 2-Ketopropionic acid; Pyroracemic acid; Propanoic acid, 2-oxo-; 2-Oxopropanoate; Pyruvate |
In Other Databases
| PubChem | 1060 |
| ChemSpider | 1031 |
| LipidsMAPs | LMFA01060077 |
| Wikipedia | Pyruvic acid |
| ChemIDPlus | 000113246; 000127173; 004151331; 000057603; 067254313; 002922614; 052009140 |
| ChEBI | CHEBI:32816 |
| HMDb | HMDB00243 |
| KEGG | C00022 |
| ChEMBL | CHEMBL1162144 |