Diaminopimelic acid
1184
Reference
Diaminopimelic acid Structure
Systematic / IUPAC Name: 2,6-Diaminoheptanedioic acid
ID: Reference1184
Other Names:
2,6-Diaminopimelic acid;
Diaminopimelic acid;
Heptanedioic acid, 2,6-diamino-;
1,5-Diaminoheptanedioic acid;
α,ε-Diaminopimelic acid
Formula: C7H14N2O4
Class: Endogenous Metabolites
Spectral Data
Diaminopimelic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
Available MS Data
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 73 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/5/2014 8:42:13 AM |
Identificators
| InChI | InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13) |
| InChI Key | GMKMEZVLHJARHF-UHFFFAOYSA-N |
| Canonical SMILES | C(CC(C(=O)O)N)CC(C(=O)O)N |
| CAS | 583937 |
| Splash | |
| Other Names |
2,6-Diaminopimelic acid; Diaminopimelic acid; Heptanedioic acid, 2,6-diamino-; 1,5-Diaminoheptanedioic acid; α,ε-Diaminopimelic acid |
In Other Databases
| PubChem | 865 |
| Wikipedia | Diaminopimelic acid |
| ChemSpider | 842 |
| ChEBI | CHEBI:23673 |
| HMDb | HMDB01370 |
| ChemIDPlus | 000583937 |